C14H15ClN4 — CID 133376620
2-chloro-4-[3-imidazol-1-ylpropyl(methyl)amino]benzonitrile (PubChem CID 133376620) has the molecular formula C14H15ClN4 and a molecular weight of 274.76 g/mol. Its IUPAC name is 2-chloro-4-[3-imidazol-1-ylpropyl(methyl)amino]benzonitrile.
| Compound Name | 2-chloro-4-[3-imidazol-1-ylpropyl(methyl)amino]benzonitrile |
|---|---|
| PubChem CID | 133376620 |
| Molecular Formula | C14H15ClN4 |
| Molecular Weight | 274.76 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-chloro-4-[3-imidazol-1-ylpropyl(methyl)amino]benzonitrile |
| SMILES | CN(CCCn1ccnc1)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C14H15ClN4/c1-18(6-2-7-19-8-5-17-11-19)13-4-3-12(10-16)14(15)9-13/h3-5,8-9,11H,2,6-7H2,1H3 |
| InChIKey | YSTBFOQXXLSBJP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.76 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |