C22H24N4O — CID 133377678
N-(6-oxaspiro[4.5]decan-9-yl)-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 133377678) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is N-(6-oxaspiro[4.5]decan-9-yl)-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-(6-oxaspiro[4.5]decan-9-yl)-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 133377678 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-(6-oxaspiro[4.5]decan-9-yl)-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | c1cncc(-c2nc(NC3CCOC4(CCCC4)C3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C22H24N4O/c1-2-8-19-18(7-1)21(26-20(25-19)16-6-5-12-23-15-16)24-17-9-13-27-22(14-17)10-3-4-11-22/h1-2,5-8,12,15,17H,3-4,9-11,13-14H2,(H,24,25,26) |
| InChIKey | ZIQJOOVGOPCNGT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |