C16H20N2OS — CID 133377793
N-(6-oxaspiro[4.5]decan-9-yl)thieno[3,2-b]pyridin-7-amine (PubChem CID 133377793) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is N-(6-oxaspiro[4.5]decan-9-yl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | N-(6-oxaspiro[4.5]decan-9-yl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 133377793 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-(6-oxaspiro[4.5]decan-9-yl)thieno[3,2-b]pyridin-7-amine |
| SMILES | c1cc(NC2CCOC3(CCCC3)C2)c2sccc2n1 |
| InChI | InChI=1S/C16H20N2OS/c1-2-7-16(6-1)11-12(4-9-19-16)18-14-3-8-17-13-5-10-20-15(13)14/h3,5,8,10,12H,1-2,4,6-7,9,11H2,(H,17,18) |
| InChIKey | ZRVXOBSWZMRLSR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |