C13H21N3OS — CID 133378493
6-ethoxy-N-(2-ethylsulfanylcyclopentyl)pyrazin-2-amine (PubChem CID 133378493) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 6-ethoxy-N-(2-ethylsulfanylcyclopentyl)pyrazin-2-amine.
| Compound Name | 6-ethoxy-N-(2-ethylsulfanylcyclopentyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 133378493 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 6-ethoxy-N-(2-ethylsulfanylcyclopentyl)pyrazin-2-amine |
| SMILES | CCOc1cncc(NC2CCCC2SCC)n1 |
| InChI | InChI=1S/C13H21N3OS/c1-3-17-13-9-14-8-12(16-13)15-10-6-5-7-11(10)18-4-2/h8-11H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | QDMLNRXJWKCJFD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |