C18H27ClN4O — CID 133378895
2-[4-(2-chloro-4-pyridinyl)piperazin-1-yl]-N-(4-methylcyclohexyl)acetamide (PubChem CID 133378895) has the molecular formula C18H27ClN4O and a molecular weight of 350.89 g/mol. Its IUPAC name is 2-[4-(2-chloro-4-pyridinyl)piperazin-1-yl]-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-[4-(2-chloro-4-pyridinyl)piperazin-1-yl]-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 133378895 |
| Molecular Formula | C18H27ClN4O |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 2-[4-(2-chloro-4-pyridinyl)piperazin-1-yl]-N-(4-methylcyclohexyl)acetamide |
| SMILES | CC1CCC(NC(=O)CN2CCN(c3ccnc(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C18H27ClN4O/c1-14-2-4-15(5-3-14)21-18(24)13-22-8-10-23(11-9-22)16-6-7-20-17(19)12-16/h6-7,12,14-15H,2-5,8-11,13H2,1H3,(H,21,24) |
| InChIKey | JWBZGLTUMLLISW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|