C19H17F3N4OS — CID 133379378
2-methyl-4-[2-pyridin-2-yl-6-(trifluoromethyl)pyrimidin-4-yl]-6-thiophen-3-ylmorpholine (PubChem CID 133379378) has the molecular formula C19H17F3N4OS and a molecular weight of 406.43 g/mol. Its IUPAC name is 2-methyl-4-[2-pyridin-2-yl-6-(trifluoromethyl)pyrimidin-4-yl]-6-thiophen-3-ylmorpholine.
| Compound Name | 2-methyl-4-[2-pyridin-2-yl-6-(trifluoromethyl)pyrimidin-4-yl]-6-thiophen-3-ylmorpholine |
|---|---|
| PubChem CID | 133379378 |
| Molecular Formula | C19H17F3N4OS |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-methyl-4-[2-pyridin-2-yl-6-(trifluoromethyl)pyrimidin-4-yl]-6-thiophen-3-ylmorpholine |
| SMILES | CC1CN(c2cc(C(F)(F)F)nc(-c3ccccn3)n2)CC(c2ccsc2)O1 |
| InChI | InChI=1S/C19H17F3N4OS/c1-12-9-26(10-15(27-12)13-5-7-28-11-13)17-8-16(19(20,21)22)24-18(25-17)14-4-2-3-6-23-14/h2-8,11-12,15H,9-10H2,1H3 |
| InChIKey | YRYFOTVZKBFCTO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |