C11H9Cl3N4O2 — CID 133380325
3-chloro-N-[(4,5-dichloro-1-methylpyrrol-2-yl)methyl]-5-nitropyridin-2-amine (PubChem CID 133380325) has the molecular formula C11H9Cl3N4O2 and a molecular weight of 335.58 g/mol. Its IUPAC name is 3-chloro-N-[(4,5-dichloro-1-methylpyrrol-2-yl)methyl]-5-nitropyridin-2-amine.
| Compound Name | 3-chloro-N-[(4,5-dichloro-1-methylpyrrol-2-yl)methyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 133380325 |
| Molecular Formula | C11H9Cl3N4O2 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 3-chloro-N-[(4,5-dichloro-1-methylpyrrol-2-yl)methyl]-5-nitropyridin-2-amine |
| SMILES | Cn1c(CNc2ncc([N+](=O)[O-])cc2Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C11H9Cl3N4O2/c1-17-6(2-8(12)10(17)14)4-15-11-9(13)3-7(5-16-11)18(19)20/h2-3,5H,4H2,1H3,(H,15,16) |
| InChIKey | DSYXYYSBOWJFRE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|