C11H16N4O2 — CID 133380624
5-[[(6-methylpyrimidin-4-yl)amino]methyl]oxolane-2-carboxamide (PubChem CID 133380624) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 5-[[(6-methylpyrimidin-4-yl)amino]methyl]oxolane-2-carboxamide.
| Compound Name | 5-[[(6-methylpyrimidin-4-yl)amino]methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 133380624 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 5-[[(6-methylpyrimidin-4-yl)amino]methyl]oxolane-2-carboxamide |
| SMILES | Cc1cc(NCC2CCC(C(N)=O)O2)ncn1 |
| InChI | InChI=1S/C11H16N4O2/c1-7-4-10(15-6-14-7)13-5-8-2-3-9(17-8)11(12)16/h4,6,8-9H,2-3,5H2,1H3,(H2,12,16)(H,13,14,15) |
| InChIKey | OSPDDYYMPUSKJP-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |