C8H16N2O4S — CID 167938136
5-[(ethylsulfonylamino)methyl]oxolane-2-carboxamide (PubChem CID 167938136) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is 5-[(ethylsulfonylamino)methyl]oxolane-2-carboxamide.
| Compound Name | 5-[(ethylsulfonylamino)methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 167938136 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 5-[(ethylsulfonylamino)methyl]oxolane-2-carboxamide |
| SMILES | CCS(=O)(=O)NCC1CCC(C(N)=O)O1 |
| InChI | InChI=1S/C8H16N2O4S/c1-2-15(12,13)10-5-6-3-4-7(14-6)8(9)11/h6-7,10H,2-5H2,1H3,(H2,9,11) |
| InChIKey | LJYNBJBNOBNDMA-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |