C11H20N4O — CID 133381871
2-N-(3-ethoxypropyl)-4-N,4-N-dimethylpyrimidine-2,4-diamine (PubChem CID 133381871) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-N-(3-ethoxypropyl)-4-N,4-N-dimethylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-ethoxypropyl)-4-N,4-N-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133381871 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2-N-(3-ethoxypropyl)-4-N,4-N-dimethylpyrimidine-2,4-diamine |
| SMILES | CCOCCCNc1nccc(N(C)C)n1 |
| InChI | InChI=1S/C11H20N4O/c1-4-16-9-5-7-12-11-13-8-6-10(14-11)15(2)3/h6,8H,4-5,7,9H2,1-3H3,(H,12,13,14) |
| InChIKey | VNQMOIIKGYNRJM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|