C17H17BrN4O — CID 133385160
6-[(4-bromo-2-morpholin-4-ylphenyl)methylamino]pyridine-3-carbonitrile (PubChem CID 133385160) has the molecular formula C17H17BrN4O and a molecular weight of 373.25 g/mol. Its IUPAC name is 6-[(4-bromo-2-morpholin-4-ylphenyl)methylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[(4-bromo-2-morpholin-4-ylphenyl)methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133385160 |
| Molecular Formula | C17H17BrN4O |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 6-[(4-bromo-2-morpholin-4-ylphenyl)methylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NCc2ccc(Br)cc2N2CCOCC2)nc1 |
| InChI | InChI=1S/C17H17BrN4O/c18-15-3-2-14(16(9-15)22-5-7-23-8-6-22)12-21-17-4-1-13(10-19)11-20-17/h1-4,9,11H,5-8,12H2,(H,20,21) |
| InChIKey | CZWIRDXABCKKCC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |