C18H19N3O5 — CID 133385585
4-(3,4-dihydro-2H-1,5-benzodioxepin-6-ylmethylamino)-N-methyl-3-nitrobenzamide (PubChem CID 133385585) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-1,5-benzodioxepin-6-ylmethylamino)-N-methyl-3-nitrobenzamide.
| Compound Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-6-ylmethylamino)-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 133385585 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-6-ylmethylamino)-N-methyl-3-nitrobenzamide |
| SMILES | CNC(=O)c1ccc(NCc2cccc3c2OCCCO3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N3O5/c1-19-18(22)12-6-7-14(15(10-12)21(23)24)20-11-13-4-2-5-16-17(13)26-9-3-8-25-16/h2,4-7,10,20H,3,8-9,11H2,1H3,(H,19,22) |
| InChIKey | UJJQNUOSLULYAJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|