C17H21BrFN3O3S — CID 133387094
6-bromo-7-fluoro-2-[4-(3-methoxypropylsulfonyl)piperazin-1-yl]quinoline (PubChem CID 133387094) has the molecular formula C17H21BrFN3O3S and a molecular weight of 446.34 g/mol. Its IUPAC name is 6-bromo-7-fluoro-2-[4-(3-methoxypropylsulfonyl)piperazin-1-yl]quinoline.
| Compound Name | 6-bromo-7-fluoro-2-[4-(3-methoxypropylsulfonyl)piperazin-1-yl]quinoline |
|---|---|
| PubChem CID | 133387094 |
| Molecular Formula | C17H21BrFN3O3S |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 6-bromo-7-fluoro-2-[4-(3-methoxypropylsulfonyl)piperazin-1-yl]quinoline |
| SMILES | COCCCS(=O)(=O)N1CCN(c2ccc3cc(Br)c(F)cc3n2)CC1 |
| InChI | InChI=1S/C17H21BrFN3O3S/c1-25-9-2-10-26(23,24)22-7-5-21(6-8-22)17-4-3-13-11-14(18)15(19)12-16(13)20-17/h3-4,11-12H,2,5-10H2,1H3 |
| InChIKey | BHWYLYALGSNNNW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|