C15H22ClN3O2 — CID 133387283
ethyl 1-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-3-methylpyrrolidine-3-carboxylate (PubChem CID 133387283) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is ethyl 1-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-3-methylpyrrolidine-3-carboxylate.
| Compound Name | ethyl 1-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-3-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 133387283 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | ethyl 1-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-3-methylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1(C)CCN(c2nc(C)nc(Cl)c2CC)C1 |
| InChI | InChI=1S/C15H22ClN3O2/c1-5-11-12(16)17-10(3)18-13(11)19-8-7-15(4,9-19)14(20)21-6-2/h5-9H2,1-4H3 |
| InChIKey | HXCQHMNBIBUPET-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |