About 4-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-2,2-diethyl-1,4-thiazinane 1-oxide
4-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-2,2-diethyl-1,4-thiazinane 1-oxide (PubChem CID 133479594) has the molecular formula C15H24ClN3OS
and a molecular weight of 329.90 g/mol. Its IUPAC name is 4-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-2,2-diethyl-1,4-thiazinane 1-oxide.
Molecular Properties
| Compound Name | 4-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-2,2-diethyl-1,4-thiazinane 1-oxide |
| PubChem CID | 133479594 |
| Molecular Formula | C15H24ClN3OS |
| Molecular Weight | 329.90 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 4-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-2,2-diethyl-1,4-thiazinane 1-oxide |
| SMILES | CCc1c(Cl)nc(C)nc1N1CCS(=O)C(CC)(CC)C1 |
| InChI | InChI=1S/C15H24ClN3OS/c1-5-12-13(16)17-11(4)18-14(12)19-8-9-21(20)15(6-2,7-3)10-19/h5-10H2,1-4H3 |
| InChIKey | OHGCDHGKPNIITC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.90 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-2,2-diethyl-1,4-thiazinane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-2,2-diethyl-1,4-thiazinane 1-oxide?
The IUPAC name of 4-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-2,2-diethyl-1,4-thiazinane 1-oxide (CID 133479594) is 4-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-2,2-diethyl-1,4-thiazinane 1-oxide.
What is the SMILES notation for 4-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-2,2-diethyl-1,4-thiazinane 1-oxide?
The canonical SMILES for 4-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-2,2-diethyl-1,4-thiazinane 1-oxide is CCc1c(Cl)nc(C)nc1N1CCS(=O)C(CC)(CC)C1.
What is the InChIKey of 4-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-2,2-diethyl-1,4-thiazinane 1-oxide?
The InChIKey is OHGCDHGKPNIITC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24ClN3OS/c1-5-12-13(16)17-11(4)18-14(12)19-8-9-21(20)15(6-2,7-3)10-19/h5-10H2,1-4H3.
What are the key properties of 4-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-2,2-diethyl-1,4-thiazinane 1-oxide?
4-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-2,2-diethyl-1,4-thiazinane 1-oxide has a molecular weight of 329.90 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-chloro-5-ethyl-2-methylpyrimidin-4-yl)-2,2-diethyl-1,4-thiazinane 1-oxide is sourced from PubChem (CID 133479594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).