C17H18FN5O — CID 133387403
N-[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]-2-(methoxymethyl)-6-methylpyrimidin-4-amine (PubChem CID 133387403) has the molecular formula C17H18FN5O and a molecular weight of 327.36 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]-2-(methoxymethyl)-6-methylpyrimidin-4-amine.
| Compound Name | N-[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]-2-(methoxymethyl)-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133387403 |
| Molecular Formula | C17H18FN5O |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]-2-(methoxymethyl)-6-methylpyrimidin-4-amine |
| SMILES | COCc1nc(C)cc(Nc2cnn(-c3ccccc3F)c2C)n1 |
| InChI | InChI=1S/C17H18FN5O/c1-11-8-16(22-17(20-11)10-24-3)21-14-9-19-23(12(14)2)15-7-5-4-6-13(15)18/h4-9H,10H2,1-3H3,(H,20,21,22) |
| InChIKey | HMYAZIZCLLKQLT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |