C15H15F4N3 — CID 133388022
2,3,5,6-tetrafluoro-N-[2-methyl-1-(3-methyl-2-pyridinyl)propyl]pyridin-4-amine (PubChem CID 133388022) has the molecular formula C15H15F4N3 and a molecular weight of 313.30 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[2-methyl-1-(3-methyl-2-pyridinyl)propyl]pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-[2-methyl-1-(3-methyl-2-pyridinyl)propyl]pyridin-4-amine |
|---|---|
| PubChem CID | 133388022 |
| Molecular Formula | C15H15F4N3 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[2-methyl-1-(3-methyl-2-pyridinyl)propyl]pyridin-4-amine |
| SMILES | Cc1cccnc1C(Nc1c(F)c(F)nc(F)c1F)C(C)C |
| InChI | InChI=1S/C15H15F4N3/c1-7(2)11(12-8(3)5-4-6-20-12)21-13-9(16)14(18)22-15(19)10(13)17/h4-7,11H,1-3H3,(H,21,22) |
| InChIKey | BYCNWVYXQSQDBA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|