C16H19F3N8O — CID 133388201
5-[[4-[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperazin-1-yl]methyl]-3-methyl-1,2,4-oxadiazole (PubChem CID 133388201) has the molecular formula C16H19F3N8O and a molecular weight of 396.38 g/mol. Its IUPAC name is 5-[[4-[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperazin-1-yl]methyl]-3-methyl-1,2,4-oxadiazole.
| Compound Name | 5-[[4-[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperazin-1-yl]methyl]-3-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133388201 |
| Molecular Formula | C16H19F3N8O |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 5-[[4-[7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperazin-1-yl]methyl]-3-methyl-1,2,4-oxadiazole |
| SMILES | Cc1noc(CN2CCN(c3nn4c(C(F)(F)F)nnc4c(C)c3C)CC2)n1 |
| InChI | InChI=1S/C16H19F3N8O/c1-9-10(2)14(23-27-13(9)21-22-15(27)16(17,18)19)26-6-4-25(5-7-26)8-12-20-11(3)24-28-12/h4-8H2,1-3H3 |
| InChIKey | OXNVREQJHQZRGI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |