C21H21N3O5 — CID 133389563
6-[1-(4-methyl-2-nitrophenyl)piperidine-4-carbonyl]-4H-1,4-benzoxazin-3-one (PubChem CID 133389563) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 6-[1-(4-methyl-2-nitrophenyl)piperidine-4-carbonyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[1-(4-methyl-2-nitrophenyl)piperidine-4-carbonyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 133389563 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 6-[1-(4-methyl-2-nitrophenyl)piperidine-4-carbonyl]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc(N2CCC(C(=O)c3ccc4c(c3)NC(=O)CO4)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H21N3O5/c1-13-2-4-17(18(10-13)24(27)28)23-8-6-14(7-9-23)21(26)15-3-5-19-16(11-15)22-20(25)12-29-19/h2-5,10-11,14H,6-9,12H2,1H3,(H,22,25) |
| InChIKey | DUPMGLDUCUMPTB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|