C18H20N4O2 — CID 133390552
6-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-N-phenylpyridazine-3-carboxamide (PubChem CID 133390552) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 6-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-N-phenylpyridazine-3-carboxamide.
| Compound Name | 6-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-N-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 133390552 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 6-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-N-phenylpyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(NCCC2=CCOCC2)nn1 |
| InChI | InChI=1S/C18H20N4O2/c23-18(20-15-4-2-1-3-5-15)16-6-7-17(22-21-16)19-11-8-14-9-12-24-13-10-14/h1-7,9H,8,10-13H2,(H,19,22)(H,20,23) |
| InChIKey | SMEXPVAAYZYMLU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|