C17H20ClN3OS — CID 133390580
3-[3-[(2-chlorophenoxy)methyl]piperidin-1-yl]-6-methylsulfanylpyridazine (PubChem CID 133390580) has the molecular formula C17H20ClN3OS and a molecular weight of 349.89 g/mol. Its IUPAC name is 3-[3-[(2-chlorophenoxy)methyl]piperidin-1-yl]-6-methylsulfanylpyridazine.
| Compound Name | 3-[3-[(2-chlorophenoxy)methyl]piperidin-1-yl]-6-methylsulfanylpyridazine |
|---|---|
| PubChem CID | 133390580 |
| Molecular Formula | C17H20ClN3OS |
| Molecular Weight | 349.89 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 3-[3-[(2-chlorophenoxy)methyl]piperidin-1-yl]-6-methylsulfanylpyridazine |
| SMILES | CSc1ccc(N2CCCC(COc3ccccc3Cl)C2)nn1 |
| InChI | InChI=1S/C17H20ClN3OS/c1-23-17-9-8-16(19-20-17)21-10-4-5-13(11-21)12-22-15-7-3-2-6-14(15)18/h2-3,6-9,13H,4-5,10-12H2,1H3 |
| InChIKey | LGFXDQCLJZPHMO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.89 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |