C15H20ClN5O2 — CID 133390785
6-chloro-3-[4-(cyclopentylmethyl)-3-oxopiperazin-1-yl]pyridazine-4-carboxamide (PubChem CID 133390785) has the molecular formula C15H20ClN5O2 and a molecular weight of 337.81 g/mol. Its IUPAC name is 6-chloro-3-[4-(cyclopentylmethyl)-3-oxopiperazin-1-yl]pyridazine-4-carboxamide.
| Compound Name | 6-chloro-3-[4-(cyclopentylmethyl)-3-oxopiperazin-1-yl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 133390785 |
| Molecular Formula | C15H20ClN5O2 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 6-chloro-3-[4-(cyclopentylmethyl)-3-oxopiperazin-1-yl]pyridazine-4-carboxamide |
| SMILES | NC(=O)c1cc(Cl)nnc1N1CCN(CC2CCCC2)C(=O)C1 |
| InChI | InChI=1S/C15H20ClN5O2/c16-12-7-11(14(17)23)15(19-18-12)21-6-5-20(13(22)9-21)8-10-3-1-2-4-10/h7,10H,1-6,8-9H2,(H2,17,23) |
| InChIKey | FEPWPXBTQVRPSW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |