C15H22ClN5O — CID 133341225
6-chloro-3-[[1-(cyclopentylmethyl)pyrrolidin-3-yl]amino]pyridazine-4-carboxamide (PubChem CID 133341225) has the molecular formula C15H22ClN5O and a molecular weight of 323.83 g/mol. Its IUPAC name is 6-chloro-3-[[1-(cyclopentylmethyl)pyrrolidin-3-yl]amino]pyridazine-4-carboxamide.
| Compound Name | 6-chloro-3-[[1-(cyclopentylmethyl)pyrrolidin-3-yl]amino]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 133341225 |
| Molecular Formula | C15H22ClN5O |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 6-chloro-3-[[1-(cyclopentylmethyl)pyrrolidin-3-yl]amino]pyridazine-4-carboxamide |
| SMILES | NC(=O)c1cc(Cl)nnc1NC1CCN(CC2CCCC2)C1 |
| InChI | InChI=1S/C15H22ClN5O/c16-13-7-12(14(17)22)15(20-19-13)18-11-5-6-21(9-11)8-10-3-1-2-4-10/h7,10-11H,1-6,8-9H2,(H2,17,22)(H,18,20) |
| InChIKey | CKSMRLFRZQUSDH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |