C18H23N3O4S2 — CID 133393831
3-methylsulfonyl-2-nitro-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]aniline (PubChem CID 133393831) has the molecular formula C18H23N3O4S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 3-methylsulfonyl-2-nitro-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]aniline.
| Compound Name | 3-methylsulfonyl-2-nitro-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 133393831 |
| Molecular Formula | C18H23N3O4S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 3-methylsulfonyl-2-nitro-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]aniline |
| SMILES | CS(=O)(=O)c1cccc(NCC2CCN(Cc3cccs3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H23N3O4S2/c1-27(24,25)17-6-2-5-16(18(17)21(22)23)19-12-14-7-9-20(10-8-14)13-15-4-3-11-26-15/h2-6,11,14,19H,7-10,12-13H2,1H3 |
| InChIKey | XKZMFJKJPVLVPI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|