C18H19ClF3N3OS — CID 133394997
4-chloro-5-(3-methylsulfanylazepan-1-yl)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one (PubChem CID 133394997) has the molecular formula C18H19ClF3N3OS and a molecular weight of 417.88 g/mol. Its IUPAC name is 4-chloro-5-(3-methylsulfanylazepan-1-yl)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one.
| Compound Name | 4-chloro-5-(3-methylsulfanylazepan-1-yl)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 133394997 |
| Molecular Formula | C18H19ClF3N3OS |
| Molecular Weight | 417.88 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 4-chloro-5-(3-methylsulfanylazepan-1-yl)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one |
| SMILES | CSC1CCCCN(c2cnn(-c3cccc(C(F)(F)F)c3)c(=O)c2Cl)C1 |
| InChI | InChI=1S/C18H19ClF3N3OS/c1-27-14-7-2-3-8-24(11-14)15-10-23-25(17(26)16(15)19)13-6-4-5-12(9-13)18(20,21)22/h4-6,9-10,14H,2-3,7-8,11H2,1H3 |
| InChIKey | SALDKILXHHKZFK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.88 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |