C15H18F3N5O — CID 133395928
(1-methylimidazol-2-yl)-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanol (PubChem CID 133395928) has the molecular formula C15H18F3N5O and a molecular weight of 341.34 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanol.
| Compound Name | (1-methylimidazol-2-yl)-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 133395928 |
| Molecular Formula | C15H18F3N5O |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | (1-methylimidazol-2-yl)-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanol |
| SMILES | Cn1ccnc1C(O)C1CCN(c2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C15H18F3N5O/c1-22-9-6-19-13(22)12(24)10-3-7-23(8-4-10)14-20-5-2-11(21-14)15(16,17)18/h2,5-6,9-10,12,24H,3-4,7-8H2,1H3 |
| InChIKey | HTBCBCGJYHCXGF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |