C14H17F3N6O — CID 28641538
[1-[[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methyl]triazol-4-yl]methanol (PubChem CID 28641538) has the molecular formula C14H17F3N6O and a molecular weight of 342.33 g/mol. Its IUPAC name is [1-[[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methyl]triazol-4-yl]methanol.
| Compound Name | [1-[[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methyl]triazol-4-yl]methanol |
|---|---|
| PubChem CID | 28641538 |
| Molecular Formula | C14H17F3N6O |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | [1-[[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methyl]triazol-4-yl]methanol |
| SMILES | OCc1cn(CC2CCN(c3nccc(C(F)(F)F)n3)CC2)nn1 |
| InChI | InChI=1S/C14H17F3N6O/c15-14(16,17)12-1-4-18-13(19-12)22-5-2-10(3-6-22)7-23-8-11(9-24)20-21-23/h1,4,8,10,24H,2-3,5-7,9H2 |
| InChIKey | AXRZOOJRNCRSLN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |