C14H17F3N6O — CID 45234626
1-[1-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]triazol-4-yl]ethanol (PubChem CID 45234626) has the molecular formula C14H17F3N6O and a molecular weight of 342.33 g/mol. Its IUPAC name is 1-[1-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]triazol-4-yl]ethanol.
| Compound Name | 1-[1-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 45234626 |
| Molecular Formula | C14H17F3N6O |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-[1-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]triazol-4-yl]ethanol |
| SMILES | CC(O)c1cn(C2CCN(c3nccc(C(F)(F)F)n3)CC2)nn1 |
| InChI | InChI=1S/C14H17F3N6O/c1-9(24)11-8-23(21-20-11)10-3-6-22(7-4-10)13-18-5-2-12(19-13)14(15,16)17/h2,5,8-10,24H,3-4,6-7H2,1H3 |
| InChIKey | YAZIGLZRAAMQHX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |