C15H19F3N6O — CID 45235002
1-[1-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]triazol-4-yl]propan-2-ol (PubChem CID 45235002) has the molecular formula C15H19F3N6O and a molecular weight of 356.35 g/mol. Its IUPAC name is 1-[1-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]triazol-4-yl]propan-2-ol.
| Compound Name | 1-[1-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]triazol-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 45235002 |
| Molecular Formula | C15H19F3N6O |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-[1-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]triazol-4-yl]propan-2-ol |
| SMILES | CC(O)Cc1cn(C2CCN(c3nccc(C(F)(F)F)n3)CC2)nn1 |
| InChI | InChI=1S/C15H19F3N6O/c1-10(25)8-11-9-24(22-21-11)12-3-6-23(7-4-12)14-19-5-2-13(20-14)15(16,17)18/h2,5,9-10,12,25H,3-4,6-8H2,1H3 |
| InChIKey | CUNZMBCZOTXCGI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |