C15H15N5O3 — CID 133397339
6-[cyclopropyl-[(2-nitrophenyl)methyl]amino]pyrazine-2-carboxamide (PubChem CID 133397339) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is 6-[cyclopropyl-[(2-nitrophenyl)methyl]amino]pyrazine-2-carboxamide.
| Compound Name | 6-[cyclopropyl-[(2-nitrophenyl)methyl]amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 133397339 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 6-[cyclopropyl-[(2-nitrophenyl)methyl]amino]pyrazine-2-carboxamide |
| SMILES | NC(=O)c1cncc(N(Cc2ccccc2[N+](=O)[O-])C2CC2)n1 |
| InChI | InChI=1S/C15H15N5O3/c16-15(21)12-7-17-8-14(18-12)19(11-5-6-11)9-10-3-1-2-4-13(10)20(22)23/h1-4,7-8,11H,5-6,9H2,(H2,16,21) |
| InChIKey | LQVOJNCQIVAWBB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 115.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|