C19H20N6O2 — CID 133397352
N-cyclopropyl-6-(3,5-dimethylpyrazol-1-yl)-N-[(2-nitrophenyl)methyl]pyridazin-3-amine (PubChem CID 133397352) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-cyclopropyl-6-(3,5-dimethylpyrazol-1-yl)-N-[(2-nitrophenyl)methyl]pyridazin-3-amine.
| Compound Name | N-cyclopropyl-6-(3,5-dimethylpyrazol-1-yl)-N-[(2-nitrophenyl)methyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 133397352 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-cyclopropyl-6-(3,5-dimethylpyrazol-1-yl)-N-[(2-nitrophenyl)methyl]pyridazin-3-amine |
| SMILES | Cc1cc(C)n(-c2ccc(N(Cc3ccccc3[N+](=O)[O-])C3CC3)nn2)n1 |
| InChI | InChI=1S/C19H20N6O2/c1-13-11-14(2)24(22-13)19-10-9-18(20-21-19)23(16-7-8-16)12-15-5-3-4-6-17(15)25(26)27/h3-6,9-11,16H,7-8,12H2,1-2H3 |
| InChIKey | WZCKFCNPSZWSQS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|