C14H14N4O2S — CID 133398030
3-[4-(2-methylsulfonylethyl)anilino]pyrazine-2-carbonitrile (PubChem CID 133398030) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-[4-(2-methylsulfonylethyl)anilino]pyrazine-2-carbonitrile.
| Compound Name | 3-[4-(2-methylsulfonylethyl)anilino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133398030 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-[4-(2-methylsulfonylethyl)anilino]pyrazine-2-carbonitrile |
| SMILES | CS(=O)(=O)CCc1ccc(Nc2nccnc2C#N)cc1 |
| InChI | InChI=1S/C14H14N4O2S/c1-21(19,20)9-6-11-2-4-12(5-3-11)18-14-13(10-15)16-7-8-17-14/h2-5,7-8H,6,9H2,1H3,(H,17,18) |
| InChIKey | AIMVCXDCFOSSGA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |