C12H10ClF3N4O — CID 133398708
6-chloro-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]pyrazin-2-amine (PubChem CID 133398708) has the molecular formula C12H10ClF3N4O and a molecular weight of 318.69 g/mol. Its IUPAC name is 6-chloro-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]pyrazin-2-amine.
| Compound Name | 6-chloro-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 133398708 |
| Molecular Formula | C12H10ClF3N4O |
| Molecular Weight | 318.69 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 6-chloro-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]pyrazin-2-amine |
| SMILES | FC(F)(F)c1cccnc1OCCNc1cncc(Cl)n1 |
| InChI | InChI=1S/C12H10ClF3N4O/c13-9-6-17-7-10(20-9)18-4-5-21-11-8(12(14,15)16)2-1-3-19-11/h1-3,6-7H,4-5H2,(H,18,20) |
| InChIKey | BEGVEKJQHVNFON-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.69 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|