C15H12F3N3O2 — CID 133398672
N-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1,3-benzoxazol-2-amine (PubChem CID 133398672) has the molecular formula C15H12F3N3O2 and a molecular weight of 323.27 g/mol. Its IUPAC name is N-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 133398672 |
| Molecular Formula | C15H12F3N3O2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1,3-benzoxazol-2-amine |
| SMILES | FC(F)(F)c1cccnc1OCCNc1nc2ccccc2o1 |
| InChI | InChI=1S/C15H12F3N3O2/c16-15(17,18)10-4-3-7-19-13(10)22-9-8-20-14-21-11-5-1-2-6-12(11)23-14/h1-7H,8-9H2,(H,20,21) |
| InChIKey | VJDZFHJLGFMEQD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|