C19H26N2O3S — CID 133400244
3-[(6-tert-butylsulfonyl-3-pyridinyl)amino]-1-phenylbutan-2-ol (PubChem CID 133400244) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is 3-[(6-tert-butylsulfonyl-3-pyridinyl)amino]-1-phenylbutan-2-ol.
| Compound Name | 3-[(6-tert-butylsulfonyl-3-pyridinyl)amino]-1-phenylbutan-2-ol |
|---|---|
| PubChem CID | 133400244 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-[(6-tert-butylsulfonyl-3-pyridinyl)amino]-1-phenylbutan-2-ol |
| SMILES | CC(Nc1ccc(S(=O)(=O)C(C)(C)C)nc1)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C19H26N2O3S/c1-14(17(22)12-15-8-6-5-7-9-15)21-16-10-11-18(20-13-16)25(23,24)19(2,3)4/h5-11,13-14,17,21-22H,12H2,1-4H3 |
| InChIKey | MXJWCPQTXOORPU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |