C20H24N4O2S — CID 133374077
N-[(1-benzylpyrazol-4-yl)methyl]-6-tert-butylsulfonylpyridin-3-amine (PubChem CID 133374077) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is N-[(1-benzylpyrazol-4-yl)methyl]-6-tert-butylsulfonylpyridin-3-amine.
| Compound Name | N-[(1-benzylpyrazol-4-yl)methyl]-6-tert-butylsulfonylpyridin-3-amine |
|---|---|
| PubChem CID | 133374077 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[(1-benzylpyrazol-4-yl)methyl]-6-tert-butylsulfonylpyridin-3-amine |
| SMILES | CC(C)(C)S(=O)(=O)c1ccc(NCc2cnn(Cc3ccccc3)c2)cn1 |
| InChI | InChI=1S/C20H24N4O2S/c1-20(2,3)27(25,26)19-10-9-18(13-22-19)21-11-17-12-23-24(15-17)14-16-7-5-4-6-8-16/h4-10,12-13,15,21H,11,14H2,1-3H3 |
| InChIKey | FJNWZGLSASKGPZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |