C25H31N5O — CID 112839507
2-(azepan-1-yl)-N-[4-[(1-benzylpyrazol-4-yl)methylamino]phenyl]acetamide (PubChem CID 112839507) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N-[4-[(1-benzylpyrazol-4-yl)methylamino]phenyl]acetamide.
| Compound Name | 2-(azepan-1-yl)-N-[4-[(1-benzylpyrazol-4-yl)methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 112839507 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 2-(azepan-1-yl)-N-[4-[(1-benzylpyrazol-4-yl)methylamino]phenyl]acetamide |
| SMILES | O=C(CN1CCCCCC1)Nc1ccc(NCc2cnn(Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H31N5O/c31-25(20-29-14-6-1-2-7-15-29)28-24-12-10-23(11-13-24)26-16-22-17-27-30(19-22)18-21-8-4-3-5-9-21/h3-5,8-13,17,19,26H,1-2,6-7,14-16,18,20H2,(H,28,31) |
| InChIKey | JGYLEHARIYHIFX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |