C19H28N4 — CID 133401112
2-ethyl-N-[2-(4-methylpiperazin-1-yl)propyl]quinolin-4-amine (PubChem CID 133401112) has the molecular formula C19H28N4 and a molecular weight of 312.46 g/mol. Its IUPAC name is 2-ethyl-N-[2-(4-methylpiperazin-1-yl)propyl]quinolin-4-amine.
| Compound Name | 2-ethyl-N-[2-(4-methylpiperazin-1-yl)propyl]quinolin-4-amine |
|---|---|
| PubChem CID | 133401112 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 2-ethyl-N-[2-(4-methylpiperazin-1-yl)propyl]quinolin-4-amine |
| SMILES | CCc1cc(NCC(C)N2CCN(C)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C19H28N4/c1-4-16-13-19(17-7-5-6-8-18(17)21-16)20-14-15(2)23-11-9-22(3)10-12-23/h5-8,13,15H,4,9-12,14H2,1-3H3,(H,20,21) |
| InChIKey | UWQWXHSWRZPBPH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |