C20H27N5O — CID 133401186
N-[1-(1H-benzimidazol-2-yl)propyl]-2-tert-butyl-6-(methoxymethyl)pyrimidin-4-amine (PubChem CID 133401186) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)propyl]-2-tert-butyl-6-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)propyl]-2-tert-butyl-6-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 133401186 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)propyl]-2-tert-butyl-6-(methoxymethyl)pyrimidin-4-amine |
| SMILES | CCC(Nc1cc(COC)nc(C(C)(C)C)n1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H27N5O/c1-6-14(18-23-15-9-7-8-10-16(15)24-18)22-17-11-13(12-26-5)21-19(25-17)20(2,3)4/h7-11,14H,6,12H2,1-5H3,(H,23,24)(H,21,22,25) |
| InChIKey | FWRZUWXZRABQGE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |