C17H17BrN2O4S — CID 133402303
N-[[1-(2-bromophenyl)cyclopropyl]methyl]-3-methylsulfonyl-4-nitroaniline (PubChem CID 133402303) has the molecular formula C17H17BrN2O4S and a molecular weight of 425.30 g/mol. Its IUPAC name is N-[[1-(2-bromophenyl)cyclopropyl]methyl]-3-methylsulfonyl-4-nitroaniline.
| Compound Name | N-[[1-(2-bromophenyl)cyclopropyl]methyl]-3-methylsulfonyl-4-nitroaniline |
|---|---|
| PubChem CID | 133402303 |
| Molecular Formula | C17H17BrN2O4S |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | N-[[1-(2-bromophenyl)cyclopropyl]methyl]-3-methylsulfonyl-4-nitroaniline |
| SMILES | CS(=O)(=O)c1cc(NCC2(c3ccccc3Br)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17BrN2O4S/c1-25(23,24)16-10-12(6-7-15(16)20(21)22)19-11-17(8-9-17)13-4-2-3-5-14(13)18/h2-7,10,19H,8-9,11H2,1H3 |
| InChIKey | SORPAYBIMMTHMZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|