C24H29N3O2S — CID 133405160
2-ethyl-N-[1-(4-ethylsulfonylphenyl)piperidin-4-yl]quinolin-4-amine (PubChem CID 133405160) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is 2-ethyl-N-[1-(4-ethylsulfonylphenyl)piperidin-4-yl]quinolin-4-amine.
| Compound Name | 2-ethyl-N-[1-(4-ethylsulfonylphenyl)piperidin-4-yl]quinolin-4-amine |
|---|---|
| PubChem CID | 133405160 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-ethyl-N-[1-(4-ethylsulfonylphenyl)piperidin-4-yl]quinolin-4-amine |
| SMILES | CCc1cc(NC2CCN(c3ccc(S(=O)(=O)CC)cc3)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C24H29N3O2S/c1-3-18-17-24(22-7-5-6-8-23(22)25-18)26-19-13-15-27(16-14-19)20-9-11-21(12-10-20)30(28,29)4-2/h5-12,17,19H,3-4,13-16H2,1-2H3,(H,25,26) |
| InChIKey | YEQNEBCQVQTGJV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |