C22H31N3O2 — CID 133405273
2-tert-butyl-4-(methoxymethyl)-6-[4-(3-methoxyphenyl)piperidin-1-yl]pyrimidine (PubChem CID 133405273) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-tert-butyl-4-(methoxymethyl)-6-[4-(3-methoxyphenyl)piperidin-1-yl]pyrimidine.
| Compound Name | 2-tert-butyl-4-(methoxymethyl)-6-[4-(3-methoxyphenyl)piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 133405273 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 2-tert-butyl-4-(methoxymethyl)-6-[4-(3-methoxyphenyl)piperidin-1-yl]pyrimidine |
| SMILES | COCc1cc(N2CCC(c3cccc(OC)c3)CC2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C22H31N3O2/c1-22(2,3)21-23-18(15-26-4)14-20(24-21)25-11-9-16(10-12-25)17-7-6-8-19(13-17)27-5/h6-8,13-14,16H,9-12,15H2,1-5H3 |
| InChIKey | WAMRFFYLWOQYIX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |