C19H28N6O2 — CID 133401963
2-tert-butyl-4-(methoxymethyl)-6-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]pyrimidine (PubChem CID 133401963) has the molecular formula C19H28N6O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-tert-butyl-4-(methoxymethyl)-6-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]pyrimidine.
| Compound Name | 2-tert-butyl-4-(methoxymethyl)-6-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 133401963 |
| Molecular Formula | C19H28N6O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 2-tert-butyl-4-(methoxymethyl)-6-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]pyrimidine |
| SMILES | COCc1cc(N2CCN(c3cncc(OC)n3)CC2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C19H28N6O2/c1-19(2,3)18-21-14(13-26-4)10-15(23-18)24-6-8-25(9-7-24)16-11-20-12-17(22-16)27-5/h10-12H,6-9,13H2,1-5H3 |
| InChIKey | IMBGDKKUYAHTAZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |