C19H26N6O3 — CID 133400967
2-tert-butyl-4-(methoxymethyl)-6-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]pyrimidine (PubChem CID 133400967) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-tert-butyl-4-(methoxymethyl)-6-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]pyrimidine.
| Compound Name | 2-tert-butyl-4-(methoxymethyl)-6-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 133400967 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-tert-butyl-4-(methoxymethyl)-6-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]pyrimidine |
| SMILES | COCc1cc(N2CCN(c3ccc([N+](=O)[O-])cn3)CC2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C19H26N6O3/c1-19(2,3)18-21-14(13-28-4)11-17(22-18)24-9-7-23(8-10-24)16-6-5-15(12-20-16)25(26)27/h5-6,11-12H,7-10,13H2,1-4H3 |
| InChIKey | SCGQKSQLFUBILS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|