C18H31N3O — CID 133402600
2-tert-butyl-4-(3-ethyl-3-methylpiperidin-1-yl)-6-(methoxymethyl)pyrimidine (PubChem CID 133402600) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is 2-tert-butyl-4-(3-ethyl-3-methylpiperidin-1-yl)-6-(methoxymethyl)pyrimidine.
| Compound Name | 2-tert-butyl-4-(3-ethyl-3-methylpiperidin-1-yl)-6-(methoxymethyl)pyrimidine |
|---|---|
| PubChem CID | 133402600 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | 2-tert-butyl-4-(3-ethyl-3-methylpiperidin-1-yl)-6-(methoxymethyl)pyrimidine |
| SMILES | CCC1(C)CCCN(c2cc(COC)nc(C(C)(C)C)n2)C1 |
| InChI | InChI=1S/C18H31N3O/c1-7-18(5)9-8-10-21(13-18)15-11-14(12-22-6)19-16(20-15)17(2,3)4/h11H,7-10,12-13H2,1-6H3 |
| InChIKey | RCLMPTJRBPNWHE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |