C16H18N4 — CID 133405681
N-[(1,5-dimethylpyrazol-4-yl)methyl]-8-methylquinolin-4-amine (PubChem CID 133405681) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methyl]-8-methylquinolin-4-amine.
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-8-methylquinolin-4-amine |
|---|---|
| PubChem CID | 133405681 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-8-methylquinolin-4-amine |
| SMILES | Cc1cccc2c(NCc3cnn(C)c3C)ccnc12 |
| InChI | InChI=1S/C16H18N4/c1-11-5-4-6-14-15(7-8-17-16(11)14)18-9-13-10-19-20(3)12(13)2/h4-8,10H,9H2,1-3H3,(H,17,18) |
| InChIKey | IRWYINDGUXSOSZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |