C19H24N4 — CID 166198008
8-methyl-N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]quinolin-4-amine (PubChem CID 166198008) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is 8-methyl-N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]quinolin-4-amine.
| Compound Name | 8-methyl-N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]quinolin-4-amine |
|---|---|
| PubChem CID | 166198008 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 8-methyl-N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]quinolin-4-amine |
| SMILES | Cc1nn(C)c(C)c1CCCNc1ccnc2c(C)cccc12 |
| InChI | InChI=1S/C19H24N4/c1-13-7-5-8-17-18(10-12-21-19(13)17)20-11-6-9-16-14(2)22-23(4)15(16)3/h5,7-8,10,12H,6,9,11H2,1-4H3,(H,20,21) |
| InChIKey | HMOKYDLSTSKSHN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|