C16H19N5 — CID 79223061
8-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]quinoline-5,8-diamine (PubChem CID 79223061) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 8-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]quinoline-5,8-diamine.
| Compound Name | 8-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]quinoline-5,8-diamine |
|---|---|
| PubChem CID | 79223061 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 8-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]quinoline-5,8-diamine |
| SMILES | Cc1nn(C)c(C)c1CNc1ccc(N)c2cccnc12 |
| InChI | InChI=1S/C16H19N5/c1-10-13(11(2)21(3)20-10)9-19-15-7-6-14(17)12-5-4-8-18-16(12)15/h4-8,19H,9,17H2,1-3H3 |
| InChIKey | HFRVBHBHTANPMJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|