C16H18ClN3O — CID 133406433
4-[3-(3-chlorophenoxy)pyrrolidin-1-yl]-2,6-dimethylpyrimidine (PubChem CID 133406433) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is 4-[3-(3-chlorophenoxy)pyrrolidin-1-yl]-2,6-dimethylpyrimidine.
| Compound Name | 4-[3-(3-chlorophenoxy)pyrrolidin-1-yl]-2,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 133406433 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-[3-(3-chlorophenoxy)pyrrolidin-1-yl]-2,6-dimethylpyrimidine |
| SMILES | Cc1cc(N2CCC(Oc3cccc(Cl)c3)C2)nc(C)n1 |
| InChI | InChI=1S/C16H18ClN3O/c1-11-8-16(19-12(2)18-11)20-7-6-15(10-20)21-14-5-3-4-13(17)9-14/h3-5,8-9,15H,6-7,10H2,1-2H3 |
| InChIKey | ARPDXDQJQLRXNI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |