C17H15ClN2O2 — CID 133406479
2-[3-(3-chlorophenoxy)pyrrolidin-1-yl]-1,3-benzoxazole (PubChem CID 133406479) has the molecular formula C17H15ClN2O2 and a molecular weight of 314.77 g/mol. Its IUPAC name is 2-[3-(3-chlorophenoxy)pyrrolidin-1-yl]-1,3-benzoxazole.
| Compound Name | 2-[3-(3-chlorophenoxy)pyrrolidin-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 133406479 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-[3-(3-chlorophenoxy)pyrrolidin-1-yl]-1,3-benzoxazole |
| SMILES | Clc1cccc(OC2CCN(c3nc4ccccc4o3)C2)c1 |
| InChI | InChI=1S/C17H15ClN2O2/c18-12-4-3-5-13(10-12)21-14-8-9-20(11-14)17-19-15-6-1-2-7-16(15)22-17/h1-7,10,14H,8-9,11H2 |
| InChIKey | GNOZBASWSRZTOO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |